C28H45N3O — CID 176984301
4-[3-(3-pentylpiperidin-1-yl)azetidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 176984301) has the molecular formula C28H45N3O and a molecular weight of 439.69 g/mol. Its IUPAC name is 4-[3-(3-pentylpiperidin-1-yl)azetidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-[3-(3-pentylpiperidin-1-yl)azetidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 176984301 |
| Molecular Formula | C28H45N3O |
| Molecular Weight | 439.69 g/mol |
| Exact Mass | 439.36 |
| IUPAC Name | 4-[3-(3-pentylpiperidin-1-yl)azetidin-1-yl]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CCCCCC1CCCN(C2CN(c3ccc(C(=O)NC4C(C)(C)CC4(C)C)cc3)C2)C1 |
| InChI | InChI=1S/C28H45N3O/c1-6-7-8-10-21-11-9-16-30(17-21)24-18-31(19-24)23-14-12-22(13-15-23)25(32)29-26-27(2,3)20-28(26,4)5/h12-15,21,24,26H,6-11,16-20H2,1-5H3,(H,29,32) |
| InChIKey | BDWASGATLZLWQR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|