C24H37N3O2 — CID 42455315
3-[(3S)-1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 42455315) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 3-[(3S)-1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[(3S)-1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 42455315 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 3-[(3S)-1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COc1ccc(N2CCC(N3CCC[C@@H](CCC(=O)N4CCCC4)C3)CC2)cc1 |
| InChI | InChI=1S/C24H37N3O2/c1-29-23-9-7-21(8-10-23)25-17-12-22(13-18-25)27-16-4-5-20(19-27)6-11-24(28)26-14-2-3-15-26/h7-10,20,22H,2-6,11-19H2,1H3/t20-/m0/s1 |
| InChIKey | JRPYTPFYHAQWOM-FQEVSTJZSA-N |
| XLogP | 3.78 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|