C26H34FN3O2 — CID 45220562
N-(2-fluorophenyl)-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]propanamide (PubChem CID 45220562) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 45220562 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-(2-fluorophenyl)-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-3-yl]propanamide |
| SMILES | COc1ccc(N2CCC(N3CCCC(CCC(=O)Nc4ccccc4F)C3)CC2)cc1 |
| InChI | InChI=1S/C26H34FN3O2/c1-32-23-11-9-21(10-12-23)29-17-14-22(15-18-29)30-16-4-5-20(19-30)8-13-26(31)28-25-7-3-2-6-24(25)27/h2-3,6-7,9-12,20,22H,4-5,8,13-19H2,1H3,(H,28,31) |
| InChIKey | UMOMRCIRNYZQBB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|