C24H40N4O2 — CID 25276266
N-[2-(dimethylamino)ethyl]-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-4-yl]propanamide (PubChem CID 25276266) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-4-yl]propanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 25276266 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[1-[1-(4-methoxyphenyl)piperidin-4-yl]piperidin-4-yl]propanamide |
| SMILES | COc1ccc(N2CCC(N3CCC(CCC(=O)NCCN(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H40N4O2/c1-26(2)19-14-25-24(29)9-4-20-10-15-27(16-11-20)22-12-17-28(18-13-22)21-5-7-23(30-3)8-6-21/h5-8,20,22H,4,9-19H2,1-3H3,(H,25,29) |
| InChIKey | OBZIDXAZEYBZGE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|