C23H36N4O4 — CID 67004989
tert-butyl-[2-[[(3R)-1-[1-(4-methoxyphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamic acid (PubChem CID 67004989) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl-[2-[[(3R)-1-[1-(4-methoxyphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamic acid.
| Compound Name | tert-butyl-[2-[[(3R)-1-[1-(4-methoxyphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 67004989 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | tert-butyl-[2-[[(3R)-1-[1-(4-methoxyphenyl)piperidin-4-yl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamic acid |
| SMILES | COc1ccc(N2CCC(N3CC[C@@H](NC(=O)CN(C(=O)O)C(C)(C)C)C3)CC2)cc1 |
| InChI | InChI=1S/C23H36N4O4/c1-23(2,3)27(22(29)30)16-21(28)24-17-9-12-26(15-17)19-10-13-25(14-11-19)18-5-7-20(31-4)8-6-18/h5-8,17,19H,9-16H2,1-4H3,(H,24,28)(H,29,30)/t17-/m1/s1 |
| InChIKey | DKAHKWVMIABLCF-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|