C27H43N3O — CID 174592791
4-butanimidoyl-N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]benzamide (PubChem CID 174592791) has the molecular formula C27H43N3O and a molecular weight of 425.66 g/mol. Its IUPAC name is 4-butanimidoyl-N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]benzamide.
| Compound Name | 4-butanimidoyl-N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 174592791 |
| Molecular Formula | C27H43N3O |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.34 |
| IUPAC Name | 4-butanimidoyl-N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]benzamide |
| SMILES | [H]/N=C(\CCC)c1ccc(C(=O)NC2CCCCC2CN2CCCC(CCCC)C2)cc1 |
| InChI | InChI=1S/C27H43N3O/c1-3-5-10-21-11-8-18-30(19-21)20-24-12-6-7-13-26(24)29-27(31)23-16-14-22(15-17-23)25(28)9-4-2/h14-17,21,24,26,28H,3-13,18-20H2,1-2H3,(H,29,31)/b28-25+ |
| InChIKey | PURZIMXKHPYKFW-AZPGRJICSA-N |
| XLogP | 6.05 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|