C29H46N4O2 — CID 69089063
4-[(4-methylpiperazin-1-yl)methyl]-N-[2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide (PubChem CID 69089063) has the molecular formula C29H46N4O2 and a molecular weight of 482.71 g/mol. Its IUPAC name is 4-[(4-methylpiperazin-1-yl)methyl]-N-[2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide.
| Compound Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 69089063 |
| Molecular Formula | C29H46N4O2 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
| SMILES | C=CCOCC1CCCN(CC2CCCCC2NC(=O)c2ccc(CN3CCN(C)CC3)cc2)C1 |
| InChI | InChI=1S/C29H46N4O2/c1-3-19-35-23-25-7-6-14-33(21-25)22-27-8-4-5-9-28(27)30-29(34)26-12-10-24(11-13-26)20-32-17-15-31(2)16-18-32/h3,10-13,25,27-28H,1,4-9,14-23H2,2H3,(H,30,34) |
| InChIKey | ZINDLPKAGUJBEY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|