C23H33ClN2O2 — CID 89323535
4-chloro-N-[(2S)-2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide (PubChem CID 89323535) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide.
| Compound Name | 4-chloro-N-[(2S)-2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 89323535 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-chloro-N-[(2S)-2-[[3-(prop-2-enoxymethyl)piperidin-1-yl]methyl]cyclohexyl]benzamide |
| SMILES | C=CCOCC1CCCN(C[C@@H]2CCCCC2NC(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H33ClN2O2/c1-2-14-28-17-18-6-5-13-26(15-18)16-20-7-3-4-8-22(20)25-23(27)19-9-11-21(24)12-10-19/h2,9-12,18,20,22H,1,3-8,13-17H2,(H,25,27)/t18?,20-,22?/m0/s1 |
| InChIKey | BFEOHPZODHVRMK-JGBTYHIZSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|