C20H38N2O2 — CID 143571188
tert-butyl N-[(2S)-2-[(3-propylpiperidin-1-yl)methyl]cyclohexyl]carbamate (PubChem CID 143571188) has the molecular formula C20H38N2O2 and a molecular weight of 338.54 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[(3-propylpiperidin-1-yl)methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[(3-propylpiperidin-1-yl)methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 143571188 |
| Molecular Formula | C20H38N2O2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.29 |
| IUPAC Name | tert-butyl N-[(2S)-2-[(3-propylpiperidin-1-yl)methyl]cyclohexyl]carbamate |
| SMILES | CCCC1CCCN(C[C@@H]2CCCCC2NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N2O2/c1-5-9-16-10-8-13-22(14-16)15-17-11-6-7-12-18(17)21-19(23)24-20(2,3)4/h16-18H,5-15H2,1-4H3,(H,21,23)/t16?,17-,18?/m0/s1 |
| InChIKey | KZJGOSSUCFWQCY-ADKAHSJRSA-N |
| XLogP | 4.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |