C21H38N2O3 — CID 71159934
tert-butyl N-[(1R,2S)-2-[[4-[(E)-but-2-enoxy]piperidin-1-yl]methyl]cyclohexyl]carbamate (PubChem CID 71159934) has the molecular formula C21H38N2O3 and a molecular weight of 366.55 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-[[4-[(E)-but-2-enoxy]piperidin-1-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-[[4-[(E)-but-2-enoxy]piperidin-1-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71159934 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-[[4-[(E)-but-2-enoxy]piperidin-1-yl]methyl]cyclohexyl]carbamate |
| SMILES | C/C=C/COC1CCN(C[C@@H]2CCCC[C@H]2NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H38N2O3/c1-5-6-15-25-18-11-13-23(14-12-18)16-17-9-7-8-10-19(17)22-20(24)26-21(2,3)4/h5-6,17-19H,7-16H2,1-4H3,(H,22,24)/b6-5+/t17-,19+/m0/s1 |
| InChIKey | HXKZFBSUKJBMRW-IIMPKJCBSA-N |
| XLogP | 4.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|