C23H34F3N3O — CID 69089206
N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 69089206) has the molecular formula C23H34F3N3O and a molecular weight of 425.54 g/mol. Its IUPAC name is N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 69089206 |
| Molecular Formula | C23H34F3N3O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[2-[(3-butylpiperidin-1-yl)methyl]cyclohexyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCCCC1CCCN(CC2CCCCC2NC(=O)c2ccc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C23H34F3N3O/c1-2-3-7-17-8-6-13-29(15-17)16-19-9-4-5-10-20(19)28-22(30)18-11-12-21(27-14-18)23(24,25)26/h11-12,14,17,19-20H,2-10,13,15-16H2,1H3,(H,28,30) |
| InChIKey | RTBGCHLAPZWPQQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |