C14H17N2OP — CID 145350331
1-[(3E)-hexa-1,3,5-trien-3-yl]-3-[4-(phosphanylmethyl)phenyl]urea (PubChem CID 145350331) has the molecular formula C14H17N2OP and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-[4-(phosphanylmethyl)phenyl]urea.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-[4-(phosphanylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 145350331 |
| Molecular Formula | C14H17N2OP |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-[4-(phosphanylmethyl)phenyl]urea |
| SMILES | C=C/C=C(\C=C)NC(=O)Nc1ccc(CP)cc1 |
| InChI | InChI=1S/C14H17N2OP/c1-3-5-12(4-2)15-14(17)16-13-8-6-11(10-18)7-9-13/h3-9H,1-2,10,18H2,(H2,15,16,17)/b12-5+ |
| InChIKey | RDXHDBOYWWWALS-LFYBBSHMSA-N |
| XLogP | 3.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|