C17H19ClN2O4 — CID 3780186
2-methoxyethyl 4-(6-chlorohexa-1,3,5-trien-3-ylcarbamoylamino)benzoate (PubChem CID 3780186) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 2-methoxyethyl 4-(6-chlorohexa-1,3,5-trien-3-ylcarbamoylamino)benzoate.
| Compound Name | 2-methoxyethyl 4-(6-chlorohexa-1,3,5-trien-3-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 3780186 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-methoxyethyl 4-(6-chlorohexa-1,3,5-trien-3-ylcarbamoylamino)benzoate |
| SMILES | C=CC(=CC=CCl)NC(=O)Nc1ccc(C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-3-14(5-4-10-18)19-17(22)20-15-8-6-13(7-9-15)16(21)24-12-11-23-2/h3-10H,1,11-12H2,2H3,(H2,19,20,22) |
| InChIKey | GXHVKONWSXZVHG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|