C24H27N3O3 — CID 157043838
tert-butyl N-[4-[[4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]carbamoyl]phenyl]carbamate (PubChem CID 157043838) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 157043838 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | tert-butyl N-[4-[[4-[[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]carbamoyl]phenyl]carbamate |
| SMILES | C=C/C=C(\C=C)Nc1ccc(NC(=O)c2ccc(NC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-6-8-18(7-2)25-19-13-15-20(16-14-19)26-22(28)17-9-11-21(12-10-17)27-23(29)30-24(3,4)5/h6-16,25H,1-2H2,3-5H3,(H,26,28)(H,27,29)/b18-8+ |
| InChIKey | TUQZGAKNQSXQOQ-QGMBQPNBSA-N |
| XLogP | 5.95 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|