C17H20N3O3+ — CID 162767912
tert-butyl N-[4-(pyridin-1-ium-1-ylcarbamoyl)phenyl]carbamate (PubChem CID 162767912) has the molecular formula C17H20N3O3+ and a molecular weight of 314.37 g/mol. Its IUPAC name is tert-butyl N-[4-(pyridin-1-ium-1-ylcarbamoyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(pyridin-1-ium-1-ylcarbamoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 162767912 |
| Molecular Formula | C17H20N3O3+ |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl N-[4-(pyridin-1-ium-1-ylcarbamoyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)N[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-17(2,3)23-16(22)18-14-9-7-13(8-10-14)15(21)19-20-11-5-4-6-12-20/h4-12H,1-3H3,(H-,18,19,21,22)/p+1 |
| InChIKey | RXAAIMIRCYQFHL-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|