C24H25N3O3 — CID 18283150
tert-butyl N-[4-[(N-phenylanilino)carbamoyl]phenyl]carbamate (PubChem CID 18283150) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is tert-butyl N-[4-[(N-phenylanilino)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(N-phenylanilino)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 18283150 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | tert-butyl N-[4-[(N-phenylanilino)carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)NN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-24(2,3)30-23(29)25-19-16-14-18(15-17-19)22(28)26-27(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17H,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | QCJNPDQNKQHERZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|