C19H22N2O3 — CID 46612138
tert-butyl N-[3-[methyl(phenyl)carbamoyl]phenyl]carbamate (PubChem CID 46612138) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is tert-butyl N-[3-[methyl(phenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[methyl(phenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46612138 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl N-[3-[methyl(phenyl)carbamoyl]phenyl]carbamate |
| SMILES | CN(C(=O)c1cccc(NC(=O)OC(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-19(2,3)24-18(23)20-15-10-8-9-14(13-15)17(22)21(4)16-11-6-5-7-12-16/h5-13H,1-4H3,(H,20,23) |
| InChIKey | NLTOWNDYKALSHF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |