C30H43N3O9 — CID 157123919
tert-butyl N-[3-[methoxy(methyl)carbamoyl]phenyl]carbamate;3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid;oxolane (PubChem CID 157123919) has the molecular formula C30H43N3O9 and a molecular weight of 589.69 g/mol. Its IUPAC name is tert-butyl N-[3-[methoxy(methyl)carbamoyl]phenyl]carbamate;3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid;oxolane.
| Compound Name | tert-butyl N-[3-[methoxy(methyl)carbamoyl]phenyl]carbamate;3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid;oxolane |
|---|---|
| PubChem CID | 157123919 |
| Molecular Formula | C30H43N3O9 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | tert-butyl N-[3-[methoxy(methyl)carbamoyl]phenyl]carbamate;3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid;oxolane |
| SMILES | C1CCOC1.CC(C)(C)OC(=O)Nc1cccc(C(=O)O)c1.CON(C)C(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C14H20N2O4.C12H15NO4.C4H8O/c1-14(2,3)20-13(18)15-11-8-6-7-10(9-11)12(17)16(4)19-5;1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15;1-2-4-5-3-1/h6-9H,1-5H3,(H,15,18);4-7H,1-3H3,(H,13,16)(H,14,15);1-4H2 |
| InChIKey | AIHJPNGPSIWERH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|