C24H35NO2 — CID 177358163
ethane;ethene;5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-carboxamide (PubChem CID 177358163) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is ethane;ethene;5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-carboxamide.
| Compound Name | ethane;ethene;5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 177358163 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | ethane;ethene;5-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[(3E)-hexa-1,3,5-trien-3-yl]furan-2-carboxamide |
| SMILES | C=C.C=C/C=C\C(=C/C)c1ccc(C(=O)N/C(C=C)=C/C=C)o1.CC.CC |
| InChI | InChI=1S/C18H19NO2.2C2H6.C2H4/c1-5-9-11-14(7-3)16-12-13-17(21-16)18(20)19-15(8-4)10-6-2;3*1-2/h5-13H,1-2,4H2,3H3,(H,19,20);2*1-2H3;1-2H2/b11-9-,14-7+,15-10+;;; |
| InChIKey | BBQFADMIIFSIQH-RPSDFMQRSA-N |
| XLogP | 7.27 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|