About N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide
N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide (PubChem CID 891927) has the molecular formula C12H16F3NO3
and a molecular weight of 279.26 g/mol. Its IUPAC name is N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide |
| PubChem CID | 891927 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(COCC(F)(F)F)o1 |
| InChI | InChI=1S/C12H16F3NO3/c1-11(2,3)16-10(17)9-5-4-8(19-9)6-18-7-12(13,14)15/h4-5H,6-7H2,1-3H3,(H,16,17) |
| InChIKey | ISQGYDHSAWFBJA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide?
The IUPAC name of N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide (CID 891927) is N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide.
What is the SMILES notation for N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide?
The canonical SMILES for N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide is CC(C)(C)NC(=O)c1ccc(COCC(F)(F)F)o1.
What is the InChIKey of N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide?
The InChIKey is ISQGYDHSAWFBJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3NO3/c1-11(2,3)16-10(17)9-5-4-8(19-9)6-18-7-12(13,14)15/h4-5H,6-7H2,1-3H3,(H,16,17).
What are the key properties of N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide?
N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide has a molecular weight of 279.26 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide is sourced from PubChem (CID 891927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).