C10H11N3O — CID 145048979
(2E,4Z)-2-cyano-N-methyl-4-(methylideneamino)hepta-2,4,6-trienamide (PubChem CID 145048979) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is (2E,4Z)-2-cyano-N-methyl-4-(methylideneamino)hepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-2-cyano-N-methyl-4-(methylideneamino)hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 145048979 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | (2E,4Z)-2-cyano-N-methyl-4-(methylideneamino)hepta-2,4,6-trienamide |
| SMILES | C=C/C=C(/C=C(\C#N)C(=O)NC)N=C |
| InChI | InChI=1S/C10H11N3O/c1-4-5-9(12-2)6-8(7-11)10(14)13-3/h4-6H,1-2H2,3H3,(H,13,14)/b8-6+,9-5- |
| InChIKey | IASQEBHPRQIVMQ-JXCGNHFNSA-N |
| XLogP | 0.95 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|