C7H9BrN2O — CID 143996514
(2E)-2-(1-aminoethenyl)-4-bromopenta-2,4-dienamide (PubChem CID 143996514) has the molecular formula C7H9BrN2O and a molecular weight of 217.07 g/mol. Its IUPAC name is (2E)-2-(1-aminoethenyl)-4-bromopenta-2,4-dienamide.
| Compound Name | (2E)-2-(1-aminoethenyl)-4-bromopenta-2,4-dienamide |
|---|---|
| PubChem CID | 143996514 |
| Molecular Formula | C7H9BrN2O |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (2E)-2-(1-aminoethenyl)-4-bromopenta-2,4-dienamide |
| SMILES | C=C(Br)/C=C(\C(=C)N)C(N)=O |
| InChI | InChI=1S/C7H9BrN2O/c1-4(8)3-6(5(2)9)7(10)11/h3H,1-2,9H2,(H2,10,11)/b6-3+ |
| InChIKey | RIWKNQDXLQGCIZ-ZZXKWVIFSA-N |
| XLogP | 0.78 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|