About 2-aminoprop-2-enamide
2-aminoprop-2-enamide (PubChem CID 3332061) has the molecular formula C3H6N2O
and a molecular weight of 86.09 g/mol. Its IUPAC name is 2-aminoprop-2-enamide.
Molecular Properties
| Compound Name | 2-aminoprop-2-enamide |
| PubChem CID | 3332061 |
| Molecular Formula | C3H6N2O |
| Molecular Weight | 86.09 g/mol |
| Exact Mass | 86.05 |
| IUPAC Name | 2-aminoprop-2-enamide |
| SMILES | C=C(N)C(N)=O |
| InChI | InChI=1S/C3H6N2O/c1-2(4)3(5)6/h1,4H2,(H2,5,6) |
| InChIKey | IUMRWGYGZHKZKF-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.09 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoprop-2-enamide?
The IUPAC name of 2-aminoprop-2-enamide (CID 3332061) is 2-aminoprop-2-enamide.
What is the SMILES notation for 2-aminoprop-2-enamide?
The canonical SMILES for 2-aminoprop-2-enamide is C=C(N)C(N)=O.
What is the InChIKey of 2-aminoprop-2-enamide?
The InChIKey is IUMRWGYGZHKZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O/c1-2(4)3(5)6/h1,4H2,(H2,5,6).
What are the key properties of 2-aminoprop-2-enamide?
2-aminoprop-2-enamide has a molecular weight of 86.09 g/mol, XLogP of -1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoprop-2-enamide is sourced from PubChem (CID 3332061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).