C28H33NP2 — CID 130280885
[[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]phosphanyl]benzene (PubChem CID 130280885) has the molecular formula C28H33NP2 and a molecular weight of 445.53 g/mol. Its IUPAC name is [[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]phosphanyl]benzene.
| Compound Name | [[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]phosphanyl]benzene |
|---|---|
| PubChem CID | 130280885 |
| Molecular Formula | C28H33NP2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]phosphanyl]benzene |
| SMILES | C=C/C=C\C(=C/C)P(NP(C(/C=C\C=C)=C/C=C)c1ccccc1)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C28H33NP2/c1-7-13-21-25(12-6)30(26(18-9-3)19-10-4)29-31(28-23-16-15-17-24-28)27(20-11-5)22-14-8-2/h7-24,29H,1-3,5H2,4,6H3/b19-10-,21-13-,22-14-,25-12+,26-18+,27-20+ |
| InChIKey | YALAAIPGEFDKIO-WFSIVRMMSA-N |
| XLogP | 8.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|