C23H36IP — CID 142091392
ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphane;iodomethane (PubChem CID 142091392) has the molecular formula C23H36IP and a molecular weight of 470.42 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphane;iodomethane.
| Compound Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphane;iodomethane |
|---|---|
| PubChem CID | 142091392 |
| Molecular Formula | C23H36IP |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | ethane;[(2E,4Z)-hexa-2,4-dien-3-yl]-[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphane;iodomethane |
| SMILES | C=C/C=C(\C=C)P(C(/C=C\C)=C/C)c1ccccc1.CC.CC.CI |
| InChI | InChI=1S/C18H21P.2C2H6.CH3I/c1-5-12-16(7-3)19(17(8-4)13-6-2)18-14-10-9-11-15-18;3*1-2/h5-15H,1,3H2,2,4H3;2*1-2H3;1H3/b13-6-,16-12+,17-8+;;; |
| InChIKey | NGKODUOSBKYHTI-OHSHLTPYSA-N |
| XLogP | 8.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|