C13H17P — CID 142398112
[(2E,4Z)-hexa-2,4-dien-3-yl]-methyl-phenylphosphane (PubChem CID 142398112) has the molecular formula C13H17P and a molecular weight of 204.25 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-3-yl]-methyl-phenylphosphane.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-3-yl]-methyl-phenylphosphane |
|---|---|
| PubChem CID | 142398112 |
| Molecular Formula | C13H17P |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-3-yl]-methyl-phenylphosphane |
| SMILES | C/C=C\C(=C/C)P(C)c1ccccc1 |
| InChI | InChI=1S/C13H17P/c1-4-9-12(5-2)14(3)13-10-7-6-8-11-13/h4-11H,1-3H3/b9-4-,12-5+ |
| InChIKey | ADVJFLRBVILALQ-AGGGZFENSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|