About borane;methyl(diphenyl)phosphane
borane;methyl(diphenyl)phosphane (PubChem CID 13485169) has the molecular formula C13H16BP
and a molecular weight of 214.06 g/mol. Its IUPAC name is borane;methyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | borane;methyl(diphenyl)phosphane |
| PubChem CID | 13485169 |
| Molecular Formula | C13H16BP |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | borane;methyl(diphenyl)phosphane |
| SMILES | B.CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13P.BH3/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-11H,1H3;1H3 |
| InChIKey | LTASEMHGSLSZHM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze borane;methyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of borane;methyl(diphenyl)phosphane?
The IUPAC name of borane;methyl(diphenyl)phosphane (CID 13485169) is borane;methyl(diphenyl)phosphane.
What is the SMILES notation for borane;methyl(diphenyl)phosphane?
The canonical SMILES for borane;methyl(diphenyl)phosphane is B.CP(c1ccccc1)c1ccccc1.
What is the InChIKey of borane;methyl(diphenyl)phosphane?
The InChIKey is LTASEMHGSLSZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13P.BH3/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;/h2-11H,1H3;1H3.
What are the key properties of borane;methyl(diphenyl)phosphane?
borane;methyl(diphenyl)phosphane has a molecular weight of 214.06 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for borane;methyl(diphenyl)phosphane is sourced from PubChem (CID 13485169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).