About gold(1+);methyl(diphenyl)phosphane;trifluoromethane
gold(1+);methyl(diphenyl)phosphane;trifluoromethane (PubChem CID 134981383) has the molecular formula C14H13AuF3P
and a molecular weight of 466.19 g/mol. Its IUPAC name is gold(1+);methyl(diphenyl)phosphane;trifluoromethane.
Molecular Properties
| Compound Name | gold(1+);methyl(diphenyl)phosphane;trifluoromethane |
| PubChem CID | 134981383 |
| Molecular Formula | C14H13AuF3P |
| Molecular Weight | 466.19 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | gold(1+);methyl(diphenyl)phosphane;trifluoromethane |
| SMILES | CP(c1ccccc1)c1ccccc1.F[C-](F)F.[Au+] |
| InChI | InChI=1S/C13H13P.CF3.Au/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2-1(3)4;/h2-11H,1H3;;/q;-1;+1 |
| InChIKey | PXNXYXXWUSOOLO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);methyl(diphenyl)phosphane;trifluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);methyl(diphenyl)phosphane;trifluoromethane?
The IUPAC name of gold(1+);methyl(diphenyl)phosphane;trifluoromethane (CID 134981383) is gold(1+);methyl(diphenyl)phosphane;trifluoromethane.
What is the SMILES notation for gold(1+);methyl(diphenyl)phosphane;trifluoromethane?
The canonical SMILES for gold(1+);methyl(diphenyl)phosphane;trifluoromethane is CP(c1ccccc1)c1ccccc1.F[C-](F)F.[Au+].
What is the InChIKey of gold(1+);methyl(diphenyl)phosphane;trifluoromethane?
The InChIKey is PXNXYXXWUSOOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13P.CF3.Au/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2-1(3)4;/h2-11H,1H3;;/q;-1;+1.
What are the key properties of gold(1+);methyl(diphenyl)phosphane;trifluoromethane?
gold(1+);methyl(diphenyl)phosphane;trifluoromethane has a molecular weight of 466.19 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);methyl(diphenyl)phosphane;trifluoromethane is sourced from PubChem (CID 134981383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).