About dimethyl(phenyl)phosphane;gold(1+);azide
dimethyl(phenyl)phosphane;gold(1+);azide (PubChem CID 166731380) has the molecular formula C8H11AuN3P
and a molecular weight of 377.14 g/mol. Its IUPAC name is dimethyl(phenyl)phosphane;gold(1+);azide.
Molecular Properties
| Compound Name | dimethyl(phenyl)phosphane;gold(1+);azide |
| PubChem CID | 166731380 |
| Molecular Formula | C8H11AuN3P |
| Molecular Weight | 377.14 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | dimethyl(phenyl)phosphane;gold(1+);azide |
| SMILES | CP(C)c1ccccc1.[Au+].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C8H11P.Au.N3/c1-9(2)8-6-4-3-5-7-8;;1-3-2/h3-7H,1-2H3;;/q;+1;-1 |
| InChIKey | AOFGUDATUNTUJL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)phosphane;gold(1+);azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)phosphane;gold(1+);azide?
The IUPAC name of dimethyl(phenyl)phosphane;gold(1+);azide (CID 166731380) is dimethyl(phenyl)phosphane;gold(1+);azide.
What is the SMILES notation for dimethyl(phenyl)phosphane;gold(1+);azide?
The canonical SMILES for dimethyl(phenyl)phosphane;gold(1+);azide is CP(C)c1ccccc1.[Au+].[N-]=[N+]=[N-].
What is the InChIKey of dimethyl(phenyl)phosphane;gold(1+);azide?
The InChIKey is AOFGUDATUNTUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11P.Au.N3/c1-9(2)8-6-4-3-5-7-8;;1-3-2/h3-7H,1-2H3;;/q;+1;-1.
What are the key properties of dimethyl(phenyl)phosphane;gold(1+);azide?
dimethyl(phenyl)phosphane;gold(1+);azide has a molecular weight of 377.14 g/mol, XLogP of 2.92, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)phosphane;gold(1+);azide is sourced from PubChem (CID 166731380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).