About dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride
dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride (PubChem CID 91487887) has the molecular formula C10H17Cl3OP2
and a molecular weight of 321.55 g/mol. Its IUPAC name is dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride.
Molecular Properties
| Compound Name | dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride |
| PubChem CID | 91487887 |
| Molecular Formula | C10H17Cl3OP2 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride |
| SMILES | CC.CP(C)c1ccccc1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H11P.C2H6.Cl3OP/c1-9(2)8-6-4-3-5-7-8;1-2;1-5(2,3)4/h3-7H,1-2H3;1-2H3; |
| InChIKey | JJOOTQMWLCFUNU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride?
The IUPAC name of dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride (CID 91487887) is dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride.
What is the SMILES notation for dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride?
The canonical SMILES for dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride is CC.CP(C)c1ccccc1.O=P(Cl)(Cl)Cl.
What is the InChIKey of dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride?
The InChIKey is JJOOTQMWLCFUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11P.C2H6.Cl3OP/c1-9(2)8-6-4-3-5-7-8;1-2;1-5(2,3)4/h3-7H,1-2H3;1-2H3;.
What are the key properties of dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride?
dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride has a molecular weight of 321.55 g/mol, XLogP of 5.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)phosphane;ethane;phosphoryl trichloride is sourced from PubChem (CID 91487887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).