About carbanide;gold(1+);methyl(diphenyl)phosphane
carbanide;gold(1+);methyl(diphenyl)phosphane (PubChem CID 87994939) has the molecular formula C14H16AuP
and a molecular weight of 412.22 g/mol. Its IUPAC name is carbanide;gold(1+);methyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | carbanide;gold(1+);methyl(diphenyl)phosphane |
| PubChem CID | 87994939 |
| Molecular Formula | C14H16AuP |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | carbanide;gold(1+);methyl(diphenyl)phosphane |
| SMILES | CP(c1ccccc1)c1ccccc1.[Au+].[CH3-] |
| InChI | InChI=1S/C13H13P.CH3.Au/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;;/h2-11H,1H3;1H3;/q;-1;+1 |
| InChIKey | UMBPEVCWVWOBNQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;gold(1+);methyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;gold(1+);methyl(diphenyl)phosphane?
The IUPAC name of carbanide;gold(1+);methyl(diphenyl)phosphane (CID 87994939) is carbanide;gold(1+);methyl(diphenyl)phosphane.
What is the SMILES notation for carbanide;gold(1+);methyl(diphenyl)phosphane?
The canonical SMILES for carbanide;gold(1+);methyl(diphenyl)phosphane is CP(c1ccccc1)c1ccccc1.[Au+].[CH3-].
What is the InChIKey of carbanide;gold(1+);methyl(diphenyl)phosphane?
The InChIKey is UMBPEVCWVWOBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13P.CH3.Au/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;;/h2-11H,1H3;1H3;/q;-1;+1.
What are the key properties of carbanide;gold(1+);methyl(diphenyl)phosphane?
carbanide;gold(1+);methyl(diphenyl)phosphane has a molecular weight of 412.22 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;gold(1+);methyl(diphenyl)phosphane is sourced from PubChem (CID 87994939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).