About ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane
ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane (PubChem CID 158097838) has the molecular formula C27H28P2
and a molecular weight of 414.47 g/mol. Its IUPAC name is ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane |
| PubChem CID | 158097838 |
| Molecular Formula | C27H28P2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane |
| SMILES | CCP(c1ccccc1)c1ccccc1.CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15P.C13H13P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h3-12H,2H2,1H3;2-11H,1H3 |
| InChIKey | FOWOWUVUHGDWAS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane?
The IUPAC name of ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane (CID 158097838) is ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane.
What is the SMILES notation for ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane?
The canonical SMILES for ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane is CCP(c1ccccc1)c1ccccc1.CP(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane?
The InChIKey is FOWOWUVUHGDWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15P.C13H13P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h3-12H,2H2,1H3;2-11H,1H3.
What are the key properties of ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane?
ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane has a molecular weight of 414.47 g/mol, XLogP of 5.89, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(diphenyl)phosphane;methyl(diphenyl)phosphane is sourced from PubChem (CID 158097838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).