About ethyl(diphenyl)phosphane;triethoxysilane
ethyl(diphenyl)phosphane;triethoxysilane (PubChem CID 161086749) has the molecular formula C20H31O3PSi
and a molecular weight of 378.53 g/mol. Its IUPAC name is ethyl(diphenyl)phosphane;triethoxysilane.
Molecular Properties
| Compound Name | ethyl(diphenyl)phosphane;triethoxysilane |
| PubChem CID | 161086749 |
| Molecular Formula | C20H31O3PSi |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl(diphenyl)phosphane;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15P.C6H16O3Si/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-7-10(8-5-2)9-6-3/h3-12H,2H2,1H3;10H,4-6H2,1-3H3 |
| InChIKey | UGPSSYCZCKOODV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl(diphenyl)phosphane;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(diphenyl)phosphane;triethoxysilane?
The IUPAC name of ethyl(diphenyl)phosphane;triethoxysilane (CID 161086749) is ethyl(diphenyl)phosphane;triethoxysilane.
What is the SMILES notation for ethyl(diphenyl)phosphane;triethoxysilane?
The canonical SMILES for ethyl(diphenyl)phosphane;triethoxysilane is CCO[SiH](OCC)OCC.CCP(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl(diphenyl)phosphane;triethoxysilane?
The InChIKey is UGPSSYCZCKOODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15P.C6H16O3Si/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-7-10(8-5-2)9-6-3/h3-12H,2H2,1H3;10H,4-6H2,1-3H3.
What are the key properties of ethyl(diphenyl)phosphane;triethoxysilane?
ethyl(diphenyl)phosphane;triethoxysilane has a molecular weight of 378.53 g/mol, XLogP of 3.95, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(diphenyl)phosphane;triethoxysilane is sourced from PubChem (CID 161086749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).