About cyclobutylbenzene;triethoxysilane
cyclobutylbenzene;triethoxysilane (PubChem CID 174943415) has the molecular formula C16H28O3Si
and a molecular weight of 296.48 g/mol. Its IUPAC name is cyclobutylbenzene;triethoxysilane.
Molecular Properties
| Compound Name | cyclobutylbenzene;triethoxysilane |
| PubChem CID | 174943415 |
| Molecular Formula | C16H28O3Si |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | cyclobutylbenzene;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.c1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C10H12.C6H16O3Si/c1-2-5-9(6-3-1)10-7-4-8-10;1-4-7-10(8-5-2)9-6-3/h1-3,5-6,10H,4,7-8H2;10H,4-6H2,1-3H3 |
| InChIKey | TURDYWVEOISWJK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclobutylbenzene;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylbenzene;triethoxysilane?
The IUPAC name of cyclobutylbenzene;triethoxysilane (CID 174943415) is cyclobutylbenzene;triethoxysilane.
What is the SMILES notation for cyclobutylbenzene;triethoxysilane?
The canonical SMILES for cyclobutylbenzene;triethoxysilane is CCO[SiH](OCC)OCC.c1ccc(C2CCC2)cc1.
What is the InChIKey of cyclobutylbenzene;triethoxysilane?
The InChIKey is TURDYWVEOISWJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.C6H16O3Si/c1-2-5-9(6-3-1)10-7-4-8-10;1-4-7-10(8-5-2)9-6-3/h1-3,5-6,10H,4,7-8H2;10H,4-6H2,1-3H3.
What are the key properties of cyclobutylbenzene;triethoxysilane?
cyclobutylbenzene;triethoxysilane has a molecular weight of 296.48 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylbenzene;triethoxysilane is sourced from PubChem (CID 174943415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).