About 3-phenylazetidine;triethoxysilane
3-phenylazetidine;triethoxysilane (PubChem CID 173466257) has the molecular formula C15H27NO3Si
and a molecular weight of 297.47 g/mol. Its IUPAC name is 3-phenylazetidine;triethoxysilane.
Molecular Properties
| Compound Name | 3-phenylazetidine;triethoxysilane |
| PubChem CID | 173466257 |
| Molecular Formula | C15H27NO3Si |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 3-phenylazetidine;triethoxysilane |
| SMILES | CCO[SiH](OCC)OCC.c1ccc(C2CNC2)cc1 |
| InChI | InChI=1S/C9H11N.C6H16O3Si/c1-2-4-8(5-3-1)9-6-10-7-9;1-4-7-10(8-5-2)9-6-3/h1-5,9-10H,6-7H2;10H,4-6H2,1-3H3 |
| InChIKey | OVHFMEGEEXBHPN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylazetidine;triethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylazetidine;triethoxysilane?
The IUPAC name of 3-phenylazetidine;triethoxysilane (CID 173466257) is 3-phenylazetidine;triethoxysilane.
What is the SMILES notation for 3-phenylazetidine;triethoxysilane?
The canonical SMILES for 3-phenylazetidine;triethoxysilane is CCO[SiH](OCC)OCC.c1ccc(C2CNC2)cc1.
What is the InChIKey of 3-phenylazetidine;triethoxysilane?
The InChIKey is OVHFMEGEEXBHPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C6H16O3Si/c1-2-4-8(5-3-1)9-6-10-7-9;1-4-7-10(8-5-2)9-6-3/h1-5,9-10H,6-7H2;10H,4-6H2,1-3H3.
What are the key properties of 3-phenylazetidine;triethoxysilane?
3-phenylazetidine;triethoxysilane has a molecular weight of 297.47 g/mol, XLogP of 2.19, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylazetidine;triethoxysilane is sourced from PubChem (CID 173466257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).