C13H15N3O2 — CID 167030744
4-amino-6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-diol (PubChem CID 167030744) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-amino-6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-diol.
| Compound Name | 4-amino-6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 167030744 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-amino-6-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-diol |
| SMILES | C=CC(=C\C=C/C)/N=N/c1cc(N)c(O)cc1O |
| InChI | InChI=1S/C13H15N3O2/c1-3-5-6-9(4-2)15-16-11-7-10(14)12(17)8-13(11)18/h3-8,17-18H,2,14H2,1H3/b5-3-,9-6+,16-15+ |
| InChIKey | XKBNHBVVXCEFHO-TUIWXIDJSA-N |
| XLogP | 3.41 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|