C21H31N3O — CID 145428610
(3E,5E)-5-[[4-amino-2,3-bis(ethenyl)phenyl]diazenyl]hepta-1,3,5-trien-3-ol;ethane (PubChem CID 145428610) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (3E,5E)-5-[[4-amino-2,3-bis(ethenyl)phenyl]diazenyl]hepta-1,3,5-trien-3-ol;ethane.
| Compound Name | (3E,5E)-5-[[4-amino-2,3-bis(ethenyl)phenyl]diazenyl]hepta-1,3,5-trien-3-ol;ethane |
|---|---|
| PubChem CID | 145428610 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (3E,5E)-5-[[4-amino-2,3-bis(ethenyl)phenyl]diazenyl]hepta-1,3,5-trien-3-ol;ethane |
| SMILES | C=C/C(O)=C\C(=C/C)\N=N\c1ccc(N)c(C=C)c1C=C.CC.CC |
| InChI | InChI=1S/C17H19N3O.2C2H6/c1-5-12(11-13(21)6-2)19-20-17-10-9-16(18)14(7-3)15(17)8-4;2*1-2/h5-11,21H,2-4,18H2,1H3;2*1-2H3/b12-5+,13-11+,20-19+;; |
| InChIKey | BFWXUGSFIJOGLQ-YXIJEDRISA-N |
| XLogP | 7.22 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|