C14H20N2 — CID 143565766
2,3-bis(ethenyl)-4-N,4-N-diethylbenzene-1,4-diamine (PubChem CID 143565766) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-N,4-N-diethylbenzene-1,4-diamine.
| Compound Name | 2,3-bis(ethenyl)-4-N,4-N-diethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 143565766 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2,3-bis(ethenyl)-4-N,4-N-diethylbenzene-1,4-diamine |
| SMILES | C=Cc1c(N)ccc(N(CC)CC)c1C=C |
| InChI | InChI=1S/C14H20N2/c1-5-11-12(6-2)14(10-9-13(11)15)16(7-3)8-4/h5-6,9-10H,1-2,7-8,15H2,3-4H3 |
| InChIKey | LYDIVMHUEPCRHX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|