About ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline
ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline (PubChem CID 171801546) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline.
Molecular Properties
| Compound Name | ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline |
| PubChem CID | 171801546 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline |
| SMILES | C=CC(=C\C(=C)C)/N=N/c1cccc(N)c1.CC |
| InChI | InChI=1S/C13H15N3.C2H6/c1-4-12(8-10(2)3)15-16-13-7-5-6-11(14)9-13;1-2/h4-9H,1-2,14H2,3H3;1-2H3/b12-8+,16-15+; |
| InChIKey | OWLNOYHCSFLZDX-GANWOVLMSA-N |
| XLogP | 5.02 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline?
The IUPAC name of ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline (CID 171801546) is ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline.
What is the SMILES notation for ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline?
The canonical SMILES for ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline is C=CC(=C\C(=C)C)/N=N/c1cccc(N)c1.CC.
What is the InChIKey of ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline?
The InChIKey is OWLNOYHCSFLZDX-GANWOVLMSA-N. The full InChI is InChI=1S/C13H15N3.C2H6/c1-4-12(8-10(2)3)15-16-13-7-5-6-11(14)9-13;1-2/h4-9H,1-2,14H2,3H3;1-2H3/b12-8+,16-15+;.
What are the key properties of ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline?
ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline has a molecular weight of 243.35 g/mol, XLogP of 5.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[[(3E)-5-methylhexa-1,3,5-trien-3-yl]diazenyl]aniline is sourced from PubChem (CID 171801546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).