C11H11NO — CID 175255088
1-(3-aminophenyl)penta-1,4-dien-3-one (PubChem CID 175255088) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 1-(3-aminophenyl)penta-1,4-dien-3-one.
| Compound Name | 1-(3-aminophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 175255088 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1-(3-aminophenyl)penta-1,4-dien-3-one |
| SMILES | C=CC(=O)C=Cc1cccc(N)c1 |
| InChI | InChI=1S/C11H11NO/c1-2-11(13)7-6-9-4-3-5-10(12)8-9/h2-8H,1,12H2 |
| InChIKey | UZBYZOMNADWXPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|