C10H16N2O2 — CID 142933869
4-amino-6-(ethylideneamino)benzene-1,3-diol;ethane (PubChem CID 142933869) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-amino-6-(ethylideneamino)benzene-1,3-diol;ethane.
| Compound Name | 4-amino-6-(ethylideneamino)benzene-1,3-diol;ethane |
|---|---|
| PubChem CID | 142933869 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-amino-6-(ethylideneamino)benzene-1,3-diol;ethane |
| SMILES | C/C=N/c1cc(N)c(O)cc1O.CC |
| InChI | InChI=1S/C8H10N2O2.C2H6/c1-2-10-6-3-5(9)7(11)4-8(6)12;1-2/h2-4,11-12H,9H2,1H3;1-2H3/b10-2+; |
| InChIKey | XOMWZLGVWRKZCE-JVSGEUHRSA-N |
| XLogP | 2.43 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|