About 2-amino-5-bromophenol;2-methylpropane
2-amino-5-bromophenol;2-methylpropane (PubChem CID 143907828) has the molecular formula C10H16BrNO
and a molecular weight of 246.15 g/mol. Its IUPAC name is 2-amino-5-bromophenol;2-methylpropane.
Molecular Properties
| Compound Name | 2-amino-5-bromophenol;2-methylpropane |
| PubChem CID | 143907828 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-amino-5-bromophenol;2-methylpropane |
| SMILES | CC(C)C.Nc1ccc(Br)cc1O |
| InChI | InChI=1S/C6H6BrNO.C4H10/c7-4-1-2-5(8)6(9)3-4;1-4(2)3/h1-3,9H,8H2;4H,1-3H3 |
| InChIKey | UEAVDZLPXLOPRF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-bromophenol;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-bromophenol;2-methylpropane?
The IUPAC name of 2-amino-5-bromophenol;2-methylpropane (CID 143907828) is 2-amino-5-bromophenol;2-methylpropane.
What is the SMILES notation for 2-amino-5-bromophenol;2-methylpropane?
The canonical SMILES for 2-amino-5-bromophenol;2-methylpropane is CC(C)C.Nc1ccc(Br)cc1O.
What is the InChIKey of 2-amino-5-bromophenol;2-methylpropane?
The InChIKey is UEAVDZLPXLOPRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO.C4H10/c7-4-1-2-5(8)6(9)3-4;1-4(2)3/h1-3,9H,8H2;4H,1-3H3.
What are the key properties of 2-amino-5-bromophenol;2-methylpropane?
2-amino-5-bromophenol;2-methylpropane has a molecular weight of 246.15 g/mol, XLogP of 3.40, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-bromophenol;2-methylpropane is sourced from PubChem (CID 143907828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).