About azane;4-bromo-2-methylaniline
azane;4-bromo-2-methylaniline (PubChem CID 175038668) has the molecular formula C7H11BrN2
and a molecular weight of 203.08 g/mol. Its IUPAC name is azane;4-bromo-2-methylaniline.
Molecular Properties
| Compound Name | azane;4-bromo-2-methylaniline |
| PubChem CID | 175038668 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | azane;4-bromo-2-methylaniline |
| SMILES | Cc1cc(Br)ccc1N.N |
| InChI | InChI=1S/C7H8BrN.H3N/c1-5-4-6(8)2-3-7(5)9;/h2-4H,9H2,1H3;1H3 |
| InChIKey | LGRGBWBICQPRTC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze azane;4-bromo-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-bromo-2-methylaniline?
The IUPAC name of azane;4-bromo-2-methylaniline (CID 175038668) is azane;4-bromo-2-methylaniline.
What is the SMILES notation for azane;4-bromo-2-methylaniline?
The canonical SMILES for azane;4-bromo-2-methylaniline is Cc1cc(Br)ccc1N.N.
What is the InChIKey of azane;4-bromo-2-methylaniline?
The InChIKey is LGRGBWBICQPRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN.H3N/c1-5-4-6(8)2-3-7(5)9;/h2-4H,9H2,1H3;1H3.
What are the key properties of azane;4-bromo-2-methylaniline?
azane;4-bromo-2-methylaniline has a molecular weight of 203.08 g/mol, XLogP of 2.50, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-bromo-2-methylaniline is sourced from PubChem (CID 175038668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).