About 2-amino-4-bromophenol;bis(4-bromophenol)
2-amino-4-bromophenol;bis(4-bromophenol) (PubChem CID 67677051) has the molecular formula C18H16Br3NO3
and a molecular weight of 534.04 g/mol. Its IUPAC name is 2-amino-4-bromophenol;bis(4-bromophenol).
Molecular Properties
| Compound Name | 2-amino-4-bromophenol;bis(4-bromophenol) |
| PubChem CID | 67677051 |
| Molecular Formula | C18H16Br3NO3 |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 530.87 |
| IUPAC Name | 2-amino-4-bromophenol;bis(4-bromophenol) |
| SMILES | Nc1cc(Br)ccc1O.Oc1ccc(Br)cc1.Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C6H6BrNO.2C6H5BrO/c7-4-1-2-6(9)5(8)3-4;2*7-5-1-3-6(8)4-2-5/h1-3,9H,8H2;2*1-4,8H |
| InChIKey | ZCZNHNFICPUVLU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-bromophenol;bis(4-bromophenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromophenol;bis(4-bromophenol)?
The IUPAC name of 2-amino-4-bromophenol;bis(4-bromophenol) (CID 67677051) is 2-amino-4-bromophenol;bis(4-bromophenol).
What is the SMILES notation for 2-amino-4-bromophenol;bis(4-bromophenol)?
The canonical SMILES for 2-amino-4-bromophenol;bis(4-bromophenol) is Nc1cc(Br)ccc1O.Oc1ccc(Br)cc1.Oc1ccc(Br)cc1.
What is the InChIKey of 2-amino-4-bromophenol;bis(4-bromophenol)?
The InChIKey is ZCZNHNFICPUVLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO.2C6H5BrO/c7-4-1-2-6(9)5(8)3-4;2*7-5-1-3-6(8)4-2-5/h1-3,9H,8H2;2*1-4,8H.
What are the key properties of 2-amino-4-bromophenol;bis(4-bromophenol)?
2-amino-4-bromophenol;bis(4-bromophenol) has a molecular weight of 534.04 g/mol, XLogP of 6.05, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromophenol;bis(4-bromophenol) is sourced from PubChem (CID 67677051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).