About 4-bromo-2-iodophenol;4-bromophenol
4-bromo-2-iodophenol;4-bromophenol (PubChem CID 70001852) has the molecular formula C12H9Br2IO2
and a molecular weight of 471.91 g/mol. Its IUPAC name is 4-bromo-2-iodophenol;4-bromophenol.
Molecular Properties
| Compound Name | 4-bromo-2-iodophenol;4-bromophenol |
| PubChem CID | 70001852 |
| Molecular Formula | C12H9Br2IO2 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 469.80 |
| IUPAC Name | 4-bromo-2-iodophenol;4-bromophenol |
| SMILES | Oc1ccc(Br)cc1.Oc1ccc(Br)cc1I |
| InChI | InChI=1S/C6H4BrIO.C6H5BrO/c7-4-1-2-6(9)5(8)3-4;7-5-1-3-6(8)4-2-5/h1-3,9H;1-4,8H |
| InChIKey | YXYUUOLYEJCZFQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-iodophenol;4-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-iodophenol;4-bromophenol?
The IUPAC name of 4-bromo-2-iodophenol;4-bromophenol (CID 70001852) is 4-bromo-2-iodophenol;4-bromophenol.
What is the SMILES notation for 4-bromo-2-iodophenol;4-bromophenol?
The canonical SMILES for 4-bromo-2-iodophenol;4-bromophenol is Oc1ccc(Br)cc1.Oc1ccc(Br)cc1I.
What is the InChIKey of 4-bromo-2-iodophenol;4-bromophenol?
The InChIKey is YXYUUOLYEJCZFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrIO.C6H5BrO/c7-4-1-2-6(9)5(8)3-4;7-5-1-3-6(8)4-2-5/h1-3,9H;1-4,8H.
What are the key properties of 4-bromo-2-iodophenol;4-bromophenol?
4-bromo-2-iodophenol;4-bromophenol has a molecular weight of 471.91 g/mol, XLogP of 4.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-iodophenol;4-bromophenol is sourced from PubChem (CID 70001852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).