C20H26N2O2 — CID 15291328
6-(5-amino-2-tert-butyl-4-hydroxyphenyl)imino-3-tert-butylcyclohexa-2,4-dien-1-one (PubChem CID 15291328) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 6-(5-amino-2-tert-butyl-4-hydroxyphenyl)imino-3-tert-butylcyclohexa-2,4-dien-1-one.
| Compound Name | 6-(5-amino-2-tert-butyl-4-hydroxyphenyl)imino-3-tert-butylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 15291328 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 6-(5-amino-2-tert-butyl-4-hydroxyphenyl)imino-3-tert-butylcyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=CC(=O)/C(=N\c2cc(N)c(O)cc2C(C)(C)C)C=C1 |
| InChI | InChI=1S/C20H26N2O2/c1-19(2,3)12-7-8-15(18(24)9-12)22-16-11-14(21)17(23)10-13(16)20(4,5)6/h7-11,23H,21H2,1-6H3/b22-15- |
| InChIKey | XVCKVWMLWIYPCB-JCMHNJIXSA-N |
| XLogP | 4.46 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'} |
|---|