C13H22N2O — CID 160952983
4-amino-1,5-ditert-butylpyridin-2-one (PubChem CID 160952983) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-amino-1,5-ditert-butylpyridin-2-one.
| Compound Name | 4-amino-1,5-ditert-butylpyridin-2-one |
|---|---|
| PubChem CID | 160952983 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-amino-1,5-ditert-butylpyridin-2-one |
| SMILES | CC(C)(C)c1cn(C(C)(C)C)c(=O)cc1N |
| InChI | InChI=1S/C13H22N2O/c1-12(2,3)9-8-15(13(4,5)6)11(16)7-10(9)14/h7-8H,14H2,1-6H3 |
| InChIKey | SNMRECFONUOWOG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |