C20H24ClNO2 — CID 139164830
4-chloro-6-(3,5-ditert-butyl-2-hydroxyphenyl)iminocyclohexa-2,4-dien-1-one (PubChem CID 139164830) has the molecular formula C20H24ClNO2 and a molecular weight of 345.87 g/mol. Its IUPAC name is 4-chloro-6-(3,5-ditert-butyl-2-hydroxyphenyl)iminocyclohexa-2,4-dien-1-one.
| Compound Name | 4-chloro-6-(3,5-ditert-butyl-2-hydroxyphenyl)iminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 139164830 |
| Molecular Formula | C20H24ClNO2 |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-chloro-6-(3,5-ditert-butyl-2-hydroxyphenyl)iminocyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)c1cc(/N=C2\C=C(Cl)C=CC2=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24ClNO2/c1-19(2,3)12-9-14(20(4,5)6)18(24)16(10-12)22-15-11-13(21)7-8-17(15)23/h7-11,24H,1-6H3/b22-15+ |
| InChIKey | AALBECHLHRTFBX-PXLXIMEGSA-N |
| XLogP | 5.32 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|