C21H27ClN2O — CID 145362108
2,4-ditert-butyl-6-[(2Z)-2-(3-chloro-6-methylidenecyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenol (PubChem CID 145362108) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(2Z)-2-(3-chloro-6-methylidenecyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(2Z)-2-(3-chloro-6-methylidenecyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenol |
|---|---|
| PubChem CID | 145362108 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2,4-ditert-butyl-6-[(2Z)-2-(3-chloro-6-methylidenecyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenol |
| SMILES | C=C1C=CC(Cl)=C/C1=N/Nc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27ClN2O/c1-13-8-9-15(22)12-17(13)23-24-18-11-14(20(2,3)4)10-16(19(18)25)21(5,6)7/h8-12,24-25H,1H2,2-7H3/b23-17- |
| InChIKey | WRCCZFQXYZYEGI-QJOMJCCJSA-N |
| XLogP | 6.00 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|