C22H33N3O — CID 143036168
2-[(2Z)-2-(6-amino-3-ethylcyclohexa-2,4-dien-1-ylidene)hydrazinyl]-4,6-ditert-butylphenol (PubChem CID 143036168) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is 2-[(2Z)-2-(6-amino-3-ethylcyclohexa-2,4-dien-1-ylidene)hydrazinyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(2Z)-2-(6-amino-3-ethylcyclohexa-2,4-dien-1-ylidene)hydrazinyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 143036168 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 2-[(2Z)-2-(6-amino-3-ethylcyclohexa-2,4-dien-1-ylidene)hydrazinyl]-4,6-ditert-butylphenol |
| SMILES | CCC1=C/C(=N/Nc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)C(N)C=C1 |
| InChI | InChI=1S/C22H33N3O/c1-8-14-9-10-17(23)18(11-14)24-25-19-13-15(21(2,3)4)12-16(20(19)26)22(5,6)7/h9-13,17,25-26H,8,23H2,1-7H3/b24-18- |
| InChIKey | RLYWGXXUTGCFEZ-MOHJPFBDSA-N |
| XLogP | 4.99 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|